C19H36O2S2 — CID 159884967
2-[(4,4-dimethyl-3-oxopentyl)disulfanyl]-9,9-dimethyldecan-5-one (PubChem CID 159884967) has the molecular formula C19H36O2S2 and a molecular weight of 360.63 g/mol. Its IUPAC name is 2-[(4,4-dimethyl-3-oxopentyl)disulfanyl]-9,9-dimethyldecan-5-one.
| Compound Name | 2-[(4,4-dimethyl-3-oxopentyl)disulfanyl]-9,9-dimethyldecan-5-one |
|---|---|
| PubChem CID | 159884967 |
| Molecular Formula | C19H36O2S2 |
| Molecular Weight | 360.63 g/mol |
| Exact Mass | 360.22 |
| IUPAC Name | 2-[(4,4-dimethyl-3-oxopentyl)disulfanyl]-9,9-dimethyldecan-5-one |
| SMILES | CC(CCC(=O)CCCC(C)(C)C)SSCCC(=O)C(C)(C)C |
| InChI | InChI=1S/C19H36O2S2/c1-15(23-22-14-12-17(21)19(5,6)7)10-11-16(20)9-8-13-18(2,3)4/h15H,8-14H2,1-7H3 |
| InChIKey | GWQFRYOTXYZFSM-UHFFFAOYSA-N |
| XLogP | 6.33 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.63 |
| LogP ≤ 5 | 6.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'disulphide', 'substructure': 'N/A'} |
|---|