C12H24OS2 — CID 164779631
6-(tert-butyldisulfanyl)-2,2-dimethylhexan-3-one (PubChem CID 164779631) has the molecular formula C12H24OS2 and a molecular weight of 248.46 g/mol. Its IUPAC name is 6-(tert-butyldisulfanyl)-2,2-dimethylhexan-3-one.
| Compound Name | 6-(tert-butyldisulfanyl)-2,2-dimethylhexan-3-one |
|---|---|
| PubChem CID | 164779631 |
| Molecular Formula | C12H24OS2 |
| Molecular Weight | 248.46 g/mol |
| Exact Mass | 248.13 |
| IUPAC Name | 6-(tert-butyldisulfanyl)-2,2-dimethylhexan-3-one |
| SMILES | CC(C)(C)SSCCCC(=O)C(C)(C)C |
| InChI | InChI=1S/C12H24OS2/c1-11(2,3)10(13)8-7-9-14-15-12(4,5)6/h7-9H2,1-6H3 |
| InChIKey | XMAQAHVKYRPTON-UHFFFAOYSA-N |
| XLogP | 4.56 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.46 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'disulphide', 'substructure': 'N/A'} |
|---|