C14H28OS2 — CID 164779616
6-(tert-butyldisulfanyl)-2,2,6-trimethylheptan-3-one (PubChem CID 164779616) has the molecular formula C14H28OS2 and a molecular weight of 276.51 g/mol. Its IUPAC name is 6-(tert-butyldisulfanyl)-2,2,6-trimethylheptan-3-one.
| Compound Name | 6-(tert-butyldisulfanyl)-2,2,6-trimethylheptan-3-one |
|---|---|
| PubChem CID | 164779616 |
| Molecular Formula | C14H28OS2 |
| Molecular Weight | 276.51 g/mol |
| Exact Mass | 276.16 |
| IUPAC Name | 6-(tert-butyldisulfanyl)-2,2,6-trimethylheptan-3-one |
| SMILES | CC(C)(C)SSC(C)(C)CCC(=O)C(C)(C)C |
| InChI | InChI=1S/C14H28OS2/c1-12(2,3)11(15)9-10-14(7,8)17-16-13(4,5)6/h9-10H2,1-8H3 |
| InChIKey | NMWAIIGTTSVREG-UHFFFAOYSA-N |
| XLogP | 5.34 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.51 |
| LogP ≤ 5 | 5.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'disulphide', 'substructure': 'N/A'} |
|---|