C35H68O2S2 — CID 161146707
1-(tert-butyldisulfanyl)-4,4-dimethylpent-1-ene;2,2,6,6-tetramethylheptan-3-one;2,2,8,8-tetramethylnon-5-en-3-one (PubChem CID 161146707) has the molecular formula C35H68O2S2 and a molecular weight of 585.06 g/mol. Its IUPAC name is 1-(tert-butyldisulfanyl)-4,4-dimethylpent-1-ene;2,2,6,6-tetramethylheptan-3-one;2,2,8,8-tetramethylnon-5-en-3-one.
| Compound Name | 1-(tert-butyldisulfanyl)-4,4-dimethylpent-1-ene;2,2,6,6-tetramethylheptan-3-one;2,2,8,8-tetramethylnon-5-en-3-one |
|---|---|
| PubChem CID | 161146707 |
| Molecular Formula | C35H68O2S2 |
| Molecular Weight | 585.06 g/mol |
| Exact Mass | 584.47 |
| IUPAC Name | 1-(tert-butyldisulfanyl)-4,4-dimethylpent-1-ene;2,2,6,6-tetramethylheptan-3-one;2,2,8,8-tetramethylnon-5-en-3-one |
| SMILES | CC(C)(C)CC=CCC(=O)C(C)(C)C.CC(C)(C)CC=CSSC(C)(C)C.CC(C)(C)CCC(=O)C(C)(C)C |
| InChI | InChI=1S/C13H24O.C11H22O.C11H22S2/c1-12(2,3)10-8-7-9-11(14)13(4,5)6;1-10(2,3)8-7-9(12)11(4,5)6;1-10(2,3)8-7-9-12-13-11(4,5)6/h7-8H,9-10H2,1-6H3;7-8H2,1-6H3;7,9H,8H2,1-6H3 |
| InChIKey | UODMNDCIYPBYLE-UHFFFAOYSA-N |
| XLogP | 12.53 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 585.06 |
| LogP ≤ 5 | 12.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'disulphide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|