C12H24OS — CID 65133303
1-tert-butylsulfanyl-5,5-dimethylhexan-2-one (PubChem CID 65133303) has the molecular formula C12H24OS and a molecular weight of 216.39 g/mol. Its IUPAC name is 1-tert-butylsulfanyl-5,5-dimethylhexan-2-one.
| Compound Name | 1-tert-butylsulfanyl-5,5-dimethylhexan-2-one |
|---|---|
| PubChem CID | 65133303 |
| Molecular Formula | C12H24OS |
| Molecular Weight | 216.39 g/mol |
| Exact Mass | 216.15 |
| IUPAC Name | 1-tert-butylsulfanyl-5,5-dimethylhexan-2-one |
| SMILES | CC(C)(C)CCC(=O)CSC(C)(C)C |
| InChI | InChI=1S/C12H24OS/c1-11(2,3)8-7-10(13)9-14-12(4,5)6/h7-9H2,1-6H3 |
| InChIKey | WYEWAUBXGIVDOP-UHFFFAOYSA-N |
| XLogP | 3.91 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.39 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |