C14H19ClOS — CID 66140142
1-(2-chlorophenyl)sulfanyl-5,5-dimethylhexan-2-one (PubChem CID 66140142) has the molecular formula C14H19ClOS and a molecular weight of 270.82 g/mol. Its IUPAC name is 1-(2-chlorophenyl)sulfanyl-5,5-dimethylhexan-2-one.
| Compound Name | 1-(2-chlorophenyl)sulfanyl-5,5-dimethylhexan-2-one |
|---|---|
| PubChem CID | 66140142 |
| Molecular Formula | C14H19ClOS |
| Molecular Weight | 270.82 g/mol |
| Exact Mass | 270.08 |
| IUPAC Name | 1-(2-chlorophenyl)sulfanyl-5,5-dimethylhexan-2-one |
| SMILES | CC(C)(C)CCC(=O)CSc1ccccc1Cl |
| InChI | InChI=1S/C14H19ClOS/c1-14(2,3)9-8-11(16)10-17-13-7-5-4-6-12(13)15/h4-7H,8-10H2,1-3H3 |
| InChIKey | MNKOCTVOJPKZLO-UHFFFAOYSA-N |
| XLogP | 4.83 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.82 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |