C14H21ClOS — CID 114212099
1-(2-chlorophenyl)sulfanyl-5,5-dimethylhexan-2-ol (PubChem CID 114212099) has the molecular formula C14H21ClOS and a molecular weight of 272.84 g/mol. Its IUPAC name is 1-(2-chlorophenyl)sulfanyl-5,5-dimethylhexan-2-ol.
| Compound Name | 1-(2-chlorophenyl)sulfanyl-5,5-dimethylhexan-2-ol |
|---|---|
| PubChem CID | 114212099 |
| Molecular Formula | C14H21ClOS |
| Molecular Weight | 272.84 g/mol |
| Exact Mass | 272.10 |
| IUPAC Name | 1-(2-chlorophenyl)sulfanyl-5,5-dimethylhexan-2-ol |
| SMILES | CC(C)(C)CCC(O)CSc1ccccc1Cl |
| InChI | InChI=1S/C14H21ClOS/c1-14(2,3)9-8-11(16)10-17-13-7-5-4-6-12(13)15/h4-7,11,16H,8-10H2,1-3H3 |
| InChIKey | ZCWQBDSROCQJGD-UHFFFAOYSA-N |
| XLogP | 4.62 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.84 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |