About 1-(2-chlorophenyl)sulfanyl-5,5-dimethylhexan-2-ol
1-(2-chlorophenyl)sulfanyl-5,5-dimethylhexan-2-ol (PubChem CID 114212099) has the molecular formula C14H21ClOS
and a molecular weight of 272.84 g/mol. Its IUPAC name is 1-(2-chlorophenyl)sulfanyl-5,5-dimethylhexan-2-ol.
Molecular Properties
| Compound Name | 1-(2-chlorophenyl)sulfanyl-5,5-dimethylhexan-2-ol |
| PubChem CID | 114212099 |
| Molecular Formula | C14H21ClOS |
| Molecular Weight | 272.84 g/mol |
| Exact Mass | 272.10 |
| IUPAC Name | 1-(2-chlorophenyl)sulfanyl-5,5-dimethylhexan-2-ol |
| SMILES | CC(C)(C)CCC(O)CSc1ccccc1Cl |
| InChI | InChI=1S/C14H21ClOS/c1-14(2,3)9-8-11(16)10-17-13-7-5-4-6-12(13)15/h4-7,11,16H,8-10H2,1-3H3 |
| InChIKey | ZCWQBDSROCQJGD-UHFFFAOYSA-N |
| XLogP | 4.62 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 272.84 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 1-(2-chlorophenyl)sulfanyl-5,5-dimethylhexan-2-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(2-chlorophenyl)sulfanyl-5,5-dimethylhexan-2-ol?
The IUPAC name of 1-(2-chlorophenyl)sulfanyl-5,5-dimethylhexan-2-ol (CID 114212099) is 1-(2-chlorophenyl)sulfanyl-5,5-dimethylhexan-2-ol.
What is the SMILES notation for 1-(2-chlorophenyl)sulfanyl-5,5-dimethylhexan-2-ol?
The canonical SMILES for 1-(2-chlorophenyl)sulfanyl-5,5-dimethylhexan-2-ol is CC(C)(C)CCC(O)CSc1ccccc1Cl.
What is the InChIKey of 1-(2-chlorophenyl)sulfanyl-5,5-dimethylhexan-2-ol?
The InChIKey is ZCWQBDSROCQJGD-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H21ClOS/c1-14(2,3)9-8-11(16)10-17-13-7-5-4-6-12(13)15/h4-7,11,16H,8-10H2,1-3H3.
What are the key properties of 1-(2-chlorophenyl)sulfanyl-5,5-dimethylhexan-2-ol?
1-(2-chlorophenyl)sulfanyl-5,5-dimethylhexan-2-ol has a molecular weight of 272.84 g/mol, XLogP of 4.62, 5 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(2-chlorophenyl)sulfanyl-5,5-dimethylhexan-2-ol is sourced from PubChem (CID 114212099), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).