C18H27ClOS — CID 66153723
1-(4-tert-butylcyclohexyl)-2-(2-chlorophenyl)sulfanylethanol (PubChem CID 66153723) has the molecular formula C18H27ClOS and a molecular weight of 326.93 g/mol. Its IUPAC name is 1-(4-tert-butylcyclohexyl)-2-(2-chlorophenyl)sulfanylethanol.
| Compound Name | 1-(4-tert-butylcyclohexyl)-2-(2-chlorophenyl)sulfanylethanol |
|---|---|
| PubChem CID | 66153723 |
| Molecular Formula | C18H27ClOS |
| Molecular Weight | 326.93 g/mol |
| Exact Mass | 326.15 |
| IUPAC Name | 1-(4-tert-butylcyclohexyl)-2-(2-chlorophenyl)sulfanylethanol |
| SMILES | CC(C)(C)C1CCC(C(O)CSc2ccccc2Cl)CC1 |
| InChI | InChI=1S/C18H27ClOS/c1-18(2,3)14-10-8-13(9-11-14)16(20)12-21-17-7-5-4-6-15(17)19/h4-7,13-14,16,20H,8-12H2,1-3H3 |
| InChIKey | DOJKTUJBEORMAY-UHFFFAOYSA-N |
| XLogP | 5.65 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.93 |
| LogP ≤ 5 | 5.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |