C14H19ClO2S — CID 116732119
3-(2-chlorophenyl)sulfanyl-1-cyclopropyl-1-ethoxypropan-2-ol (PubChem CID 116732119) has the molecular formula C14H19ClO2S and a molecular weight of 286.82 g/mol. Its IUPAC name is 3-(2-chlorophenyl)sulfanyl-1-cyclopropyl-1-ethoxypropan-2-ol.
| Compound Name | 3-(2-chlorophenyl)sulfanyl-1-cyclopropyl-1-ethoxypropan-2-ol |
|---|---|
| PubChem CID | 116732119 |
| Molecular Formula | C14H19ClO2S |
| Molecular Weight | 286.82 g/mol |
| Exact Mass | 286.08 |
| IUPAC Name | 3-(2-chlorophenyl)sulfanyl-1-cyclopropyl-1-ethoxypropan-2-ol |
| SMILES | CCOC(C(O)CSc1ccccc1Cl)C1CC1 |
| InChI | InChI=1S/C14H19ClO2S/c1-2-17-14(10-7-8-10)12(16)9-18-13-6-4-3-5-11(13)15/h3-6,10,12,14,16H,2,7-9H2,1H3 |
| InChIKey | GHHLSMDYTJZFRI-UHFFFAOYSA-N |
| XLogP | 3.61 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.82 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |