C12H17ClOS — CID 66152395
1-(2-chlorophenyl)sulfanyl-3-methylpentan-2-ol (PubChem CID 66152395) has the molecular formula C12H17ClOS and a molecular weight of 244.79 g/mol. Its IUPAC name is 1-(2-chlorophenyl)sulfanyl-3-methylpentan-2-ol.
| Compound Name | 1-(2-chlorophenyl)sulfanyl-3-methylpentan-2-ol |
|---|---|
| PubChem CID | 66152395 |
| Molecular Formula | C12H17ClOS |
| Molecular Weight | 244.79 g/mol |
| Exact Mass | 244.07 |
| IUPAC Name | 1-(2-chlorophenyl)sulfanyl-3-methylpentan-2-ol |
| SMILES | CCC(C)C(O)CSc1ccccc1Cl |
| InChI | InChI=1S/C12H17ClOS/c1-3-9(2)11(14)8-15-12-7-5-4-6-10(12)13/h4-7,9,11,14H,3,8H2,1-2H3 |
| InChIKey | KBLVUXOXGCVYBL-UHFFFAOYSA-N |
| XLogP | 3.84 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.79 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |