C16H17ClO3S — CID 60725965
2-(2-chlorophenyl)sulfanyl-1-(3,4-dimethoxyphenyl)ethanol (PubChem CID 60725965) has the molecular formula C16H17ClO3S and a molecular weight of 324.83 g/mol. Its IUPAC name is 2-(2-chlorophenyl)sulfanyl-1-(3,4-dimethoxyphenyl)ethanol.
| Compound Name | 2-(2-chlorophenyl)sulfanyl-1-(3,4-dimethoxyphenyl)ethanol |
|---|---|
| PubChem CID | 60725965 |
| Molecular Formula | C16H17ClO3S |
| Molecular Weight | 324.83 g/mol |
| Exact Mass | 324.06 |
| IUPAC Name | 2-(2-chlorophenyl)sulfanyl-1-(3,4-dimethoxyphenyl)ethanol |
| SMILES | COc1ccc(C(O)CSc2ccccc2Cl)cc1OC |
| InChI | InChI=1S/C16H17ClO3S/c1-19-14-8-7-11(9-15(14)20-2)13(18)10-21-16-6-4-3-5-12(16)17/h3-9,13,18H,10H2,1-2H3 |
| InChIKey | BSJJCSGDHRDUIE-UHFFFAOYSA-N |
| XLogP | 4.18 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.83 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |