C16H17Cl2NOS — CID 79700594
1-(4-chloro-3-methoxyphenyl)-2-(2-chlorophenyl)sulfanyl-N-methylethanamine (PubChem CID 79700594) has the molecular formula C16H17Cl2NOS and a molecular weight of 342.29 g/mol. Its IUPAC name is 1-(4-chloro-3-methoxyphenyl)-2-(2-chlorophenyl)sulfanyl-N-methylethanamine.
| Compound Name | 1-(4-chloro-3-methoxyphenyl)-2-(2-chlorophenyl)sulfanyl-N-methylethanamine |
|---|---|
| PubChem CID | 79700594 |
| Molecular Formula | C16H17Cl2NOS |
| Molecular Weight | 342.29 g/mol |
| Exact Mass | 341.04 |
| IUPAC Name | 1-(4-chloro-3-methoxyphenyl)-2-(2-chlorophenyl)sulfanyl-N-methylethanamine |
| SMILES | CNC(CSc1ccccc1Cl)c1ccc(Cl)c(OC)c1 |
| InChI | InChI=1S/C16H17Cl2NOS/c1-19-14(10-21-16-6-4-3-5-13(16)18)11-7-8-12(17)15(9-11)20-2/h3-9,14,19H,10H2,1-2H3 |
| InChIKey | UNMZTDQJVRETLX-UHFFFAOYSA-N |
| XLogP | 5.05 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.29 |
| LogP ≤ 5 | 5.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |