C12H15ClOS — CID 66153726
2-(2-chlorophenyl)sulfanyl-1-cyclobutylethanol (PubChem CID 66153726) has the molecular formula C12H15ClOS and a molecular weight of 242.77 g/mol. Its IUPAC name is 2-(2-chlorophenyl)sulfanyl-1-cyclobutylethanol.
| Compound Name | 2-(2-chlorophenyl)sulfanyl-1-cyclobutylethanol |
|---|---|
| PubChem CID | 66153726 |
| Molecular Formula | C12H15ClOS |
| Molecular Weight | 242.77 g/mol |
| Exact Mass | 242.05 |
| IUPAC Name | 2-(2-chlorophenyl)sulfanyl-1-cyclobutylethanol |
| SMILES | OC(CSc1ccccc1Cl)C1CCC1 |
| InChI | InChI=1S/C12H15ClOS/c13-10-6-1-2-7-12(10)15-8-11(14)9-4-3-5-9/h1-2,6-7,9,11,14H,3-5,8H2 |
| InChIKey | VLWCPMWWYMYROJ-UHFFFAOYSA-N |
| XLogP | 3.59 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.77 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |