C12H15ClOS2 — CID 80636553
2-(2-chlorophenyl)sulfanyl-1-(thiolan-2-yl)ethanol (PubChem CID 80636553) has the molecular formula C12H15ClOS2 and a molecular weight of 274.84 g/mol. Its IUPAC name is 2-(2-chlorophenyl)sulfanyl-1-(thiolan-2-yl)ethanol.
| Compound Name | 2-(2-chlorophenyl)sulfanyl-1-(thiolan-2-yl)ethanol |
|---|---|
| PubChem CID | 80636553 |
| Molecular Formula | C12H15ClOS2 |
| Molecular Weight | 274.84 g/mol |
| Exact Mass | 274.03 |
| IUPAC Name | 2-(2-chlorophenyl)sulfanyl-1-(thiolan-2-yl)ethanol |
| SMILES | OC(CSc1ccccc1Cl)C1CCCS1 |
| InChI | InChI=1S/C12H15ClOS2/c13-9-4-1-2-5-11(9)16-8-10(14)12-6-3-7-15-12/h1-2,4-5,10,12,14H,3,6-8H2 |
| InChIKey | ZRLASNIWKPDERC-UHFFFAOYSA-N |
| XLogP | 3.69 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.84 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |