C12H14Cl2OS — CID 80622903
2-(2,5-dichlorophenyl)-1-(thiolan-2-yl)ethanol (PubChem CID 80622903) has the molecular formula C12H14Cl2OS and a molecular weight of 277.22 g/mol. Its IUPAC name is 2-(2,5-dichlorophenyl)-1-(thiolan-2-yl)ethanol.
| Compound Name | 2-(2,5-dichlorophenyl)-1-(thiolan-2-yl)ethanol |
|---|---|
| PubChem CID | 80622903 |
| Molecular Formula | C12H14Cl2OS |
| Molecular Weight | 277.22 g/mol |
| Exact Mass | 276.01 |
| IUPAC Name | 2-(2,5-dichlorophenyl)-1-(thiolan-2-yl)ethanol |
| SMILES | OC(Cc1cc(Cl)ccc1Cl)C1CCCS1 |
| InChI | InChI=1S/C12H14Cl2OS/c13-9-3-4-10(14)8(6-9)7-11(15)12-2-1-5-16-12/h3-4,6,11-12,15H,1-2,5,7H2 |
| InChIKey | CFAXGJRODKMOQI-UHFFFAOYSA-N |
| XLogP | 3.79 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.22 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |