C17H16Cl2O — CID 65411173
2-(2,5-dichlorophenyl)-1-(2,3-dihydro-1H-inden-2-yl)ethanol (PubChem CID 65411173) has the molecular formula C17H16Cl2O and a molecular weight of 307.22 g/mol. Its IUPAC name is 2-(2,5-dichlorophenyl)-1-(2,3-dihydro-1H-inden-2-yl)ethanol.
| Compound Name | 2-(2,5-dichlorophenyl)-1-(2,3-dihydro-1H-inden-2-yl)ethanol |
|---|---|
| PubChem CID | 65411173 |
| Molecular Formula | C17H16Cl2O |
| Molecular Weight | 307.22 g/mol |
| Exact Mass | 306.06 |
| IUPAC Name | 2-(2,5-dichlorophenyl)-1-(2,3-dihydro-1H-inden-2-yl)ethanol |
| SMILES | OC(Cc1cc(Cl)ccc1Cl)C1Cc2ccccc2C1 |
| InChI | InChI=1S/C17H16Cl2O/c18-15-5-6-16(19)13(9-15)10-17(20)14-7-11-3-1-2-4-12(11)8-14/h1-6,9,14,17,20H,7-8,10H2 |
| InChIKey | YIRRYCUEGAHPDH-UHFFFAOYSA-N |
| XLogP | 4.31 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.22 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |