C12H14Cl2O3S — CID 115336404
2-(2,5-dichlorophenyl)-1-(1,1-dioxothiolan-3-yl)ethanol (PubChem CID 115336404) has the molecular formula C12H14Cl2O3S and a molecular weight of 309.21 g/mol. Its IUPAC name is 2-(2,5-dichlorophenyl)-1-(1,1-dioxothiolan-3-yl)ethanol.
| Compound Name | 2-(2,5-dichlorophenyl)-1-(1,1-dioxothiolan-3-yl)ethanol |
|---|---|
| PubChem CID | 115336404 |
| Molecular Formula | C12H14Cl2O3S |
| Molecular Weight | 309.21 g/mol |
| Exact Mass | 308.00 |
| IUPAC Name | 2-(2,5-dichlorophenyl)-1-(1,1-dioxothiolan-3-yl)ethanol |
| SMILES | O=S1(=O)CCC(C(O)Cc2cc(Cl)ccc2Cl)C1 |
| InChI | InChI=1S/C12H14Cl2O3S/c13-10-1-2-11(14)9(5-10)6-12(15)8-3-4-18(16,17)7-8/h1-2,5,8,12,15H,3-4,6-7H2 |
| InChIKey | IGDUHMTYBNPNBW-UHFFFAOYSA-N |
| XLogP | 2.33 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.21 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |