C13H15ClO4S — CID 60794066
3-(4-chlorophenyl)-2-(1,1-dioxothiolan-3-yl)propanoic acid (PubChem CID 60794066) has the molecular formula C13H15ClO4S and a molecular weight of 302.78 g/mol. Its IUPAC name is 3-(4-chlorophenyl)-2-(1,1-dioxothiolan-3-yl)propanoic acid.
| Compound Name | 3-(4-chlorophenyl)-2-(1,1-dioxothiolan-3-yl)propanoic acid |
|---|---|
| PubChem CID | 60794066 |
| Molecular Formula | C13H15ClO4S |
| Molecular Weight | 302.78 g/mol |
| Exact Mass | 302.04 |
| IUPAC Name | 3-(4-chlorophenyl)-2-(1,1-dioxothiolan-3-yl)propanoic acid |
| SMILES | O=C(O)C(Cc1ccc(Cl)cc1)C1CCS(=O)(=O)C1 |
| InChI | InChI=1S/C13H15ClO4S/c14-11-3-1-9(2-4-11)7-12(13(15)16)10-5-6-19(17,18)8-10/h1-4,10,12H,5-8H2,(H,15,16) |
| InChIKey | GIMHLPGZZMLSCS-UHFFFAOYSA-N |
| XLogP | 2.02 |
| TPSA | 71.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.78 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |