C16H21ClO3 — CID 79418786
3-(4-chlorophenyl)-2-(2-hydroxycycloheptyl)propanoic acid (PubChem CID 79418786) has the molecular formula C16H21ClO3 and a molecular weight of 296.79 g/mol. Its IUPAC name is 3-(4-chlorophenyl)-2-(2-hydroxycycloheptyl)propanoic acid.
| Compound Name | 3-(4-chlorophenyl)-2-(2-hydroxycycloheptyl)propanoic acid |
|---|---|
| PubChem CID | 79418786 |
| Molecular Formula | C16H21ClO3 |
| Molecular Weight | 296.79 g/mol |
| Exact Mass | 296.12 |
| IUPAC Name | 3-(4-chlorophenyl)-2-(2-hydroxycycloheptyl)propanoic acid |
| SMILES | O=C(O)C(Cc1ccc(Cl)cc1)C1CCCCCC1O |
| InChI | InChI=1S/C16H21ClO3/c17-12-8-6-11(7-9-12)10-14(16(19)20)13-4-2-1-3-5-15(13)18/h6-9,13-15,18H,1-5,10H2,(H,19,20) |
| InChIKey | FRANOCMGKGFING-UHFFFAOYSA-N |
| XLogP | 3.52 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.79 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |