C13H14ClFO4S — CID 103038706
3-(3-chloro-4-fluorophenyl)-2-(1,1-dioxothiolan-3-yl)propanoic acid (PubChem CID 103038706) has the molecular formula C13H14ClFO4S and a molecular weight of 320.77 g/mol. Its IUPAC name is 3-(3-chloro-4-fluorophenyl)-2-(1,1-dioxothiolan-3-yl)propanoic acid.
| Compound Name | 3-(3-chloro-4-fluorophenyl)-2-(1,1-dioxothiolan-3-yl)propanoic acid |
|---|---|
| PubChem CID | 103038706 |
| Molecular Formula | C13H14ClFO4S |
| Molecular Weight | 320.77 g/mol |
| Exact Mass | 320.03 |
| IUPAC Name | 3-(3-chloro-4-fluorophenyl)-2-(1,1-dioxothiolan-3-yl)propanoic acid |
| SMILES | O=C(O)C(Cc1ccc(F)c(Cl)c1)C1CCS(=O)(=O)C1 |
| InChI | InChI=1S/C13H14ClFO4S/c14-11-6-8(1-2-12(11)15)5-10(13(16)17)9-3-4-20(18,19)7-9/h1-2,6,9-10H,3-5,7H2,(H,16,17) |
| InChIKey | OXCCMRPSUZUHLZ-UHFFFAOYSA-N |
| XLogP | 2.16 |
| TPSA | 71.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.77 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |