C13H15BrO4S — CID 93324806
(2R)-3-(3-bromophenyl)-2-[(3R)-1,1-dioxothiolan-3-yl]propanoic acid (PubChem CID 93324806) has the molecular formula C13H15BrO4S and a molecular weight of 347.23 g/mol. Its IUPAC name is (2R)-3-(3-bromophenyl)-2-[(3R)-1,1-dioxothiolan-3-yl]propanoic acid.
| Compound Name | (2R)-3-(3-bromophenyl)-2-[(3R)-1,1-dioxothiolan-3-yl]propanoic acid |
|---|---|
| PubChem CID | 93324806 |
| Molecular Formula | C13H15BrO4S |
| Molecular Weight | 347.23 g/mol |
| Exact Mass | 345.99 |
| IUPAC Name | (2R)-3-(3-bromophenyl)-2-[(3R)-1,1-dioxothiolan-3-yl]propanoic acid |
| SMILES | O=C(O)[C@H](Cc1cccc(Br)c1)[C@H]1CCS(=O)(=O)C1 |
| InChI | InChI=1S/C13H15BrO4S/c14-11-3-1-2-9(6-11)7-12(13(15)16)10-4-5-19(17,18)8-10/h1-3,6,10,12H,4-5,7-8H2,(H,15,16)/t10-,12+/m0/s1 |
| InChIKey | JXNFFYMTEVUTMU-CMPLNLGQSA-N |
| XLogP | 2.13 |
| TPSA | 71.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.23 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |