2-(1,1-dioxothiolan-3-yl)-3-(1,3-thiazol-4-yl)propanoic acid

C10H13NO4S2 — CID 54982854

IUPAC2-(1,1-dioxothiolan-3-yl)-3-(1,3-thiazol-4-yl)propanoic acid
SMILESO=C(O)C(Cc1cscn1)C1CCS(=O)(=O)C1
InChIInChI=1S/C10H13NO4S2/c12-10(13)9(3-8-4-16-6-11-8)7-1-2-17(14,15)5-7/h4,6-7,9H,1-3,5H2,(H,12,13)
InChIKeyXMZVWRFLANDEJH-UHFFFAOYSA-N
MW275.35 g/mol
LogP0.82
Rot. Bonds4

About 2-(1,1-dioxothiolan-3-yl)-3-(1,3-thiazol-4-yl)propanoic acid

2-(1,1-dioxothiolan-3-yl)-3-(1,3-thiazol-4-yl)propanoic acid (PubChem CID 54982854) has the molecular formula C10H13NO4S2 and a molecular weight of 275.35 g/mol. Its IUPAC name is 2-(1,1-dioxothiolan-3-yl)-3-(1,3-thiazol-4-yl)propanoic acid.

Molecular Properties

Compound Name2-(1,1-dioxothiolan-3-yl)-3-(1,3-thiazol-4-yl)propanoic acid
PubChem CID54982854
Molecular FormulaC10H13NO4S2
Molecular Weight275.35 g/mol
Exact Mass275.03
IUPAC Name2-(1,1-dioxothiolan-3-yl)-3-(1,3-thiazol-4-yl)propanoic acid
SMILESO=C(O)C(Cc1cscn1)C1CCS(=O)(=O)C1
InChIInChI=1S/C10H13NO4S2/c12-10(13)9(3-8-4-16-6-11-8)7-1-2-17(14,15)5-7/h4,6-7,9H,1-3,5H2,(H,12,13)
InChIKeyXMZVWRFLANDEJH-UHFFFAOYSA-N
XLogP0.82
TPSA84.33 Ų
H-Bond Donors1
H-Bond Acceptors5
Rotatable Bonds4
Heavy Atoms17
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500275.35
LogP ≤ 50.82
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 105

Analyze 2-(1,1-dioxothiolan-3-yl)-3-(1,3-thiazol-4-yl)propanoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-(1,1-dioxothiolan-3-yl)-3-(1,3-thiazol-4-yl)propanoic acid?
The IUPAC name of 2-(1,1-dioxothiolan-3-yl)-3-(1,3-thiazol-4-yl)propanoic acid (CID 54982854) is 2-(1,1-dioxothiolan-3-yl)-3-(1,3-thiazol-4-yl)propanoic acid.
What is the SMILES notation for 2-(1,1-dioxothiolan-3-yl)-3-(1,3-thiazol-4-yl)propanoic acid?
The canonical SMILES for 2-(1,1-dioxothiolan-3-yl)-3-(1,3-thiazol-4-yl)propanoic acid is O=C(O)C(Cc1cscn1)C1CCS(=O)(=O)C1.
What is the InChIKey of 2-(1,1-dioxothiolan-3-yl)-3-(1,3-thiazol-4-yl)propanoic acid?
The InChIKey is XMZVWRFLANDEJH-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H13NO4S2/c12-10(13)9(3-8-4-16-6-11-8)7-1-2-17(14,15)5-7/h4,6-7,9H,1-3,5H2,(H,12,13).
What are the key properties of 2-(1,1-dioxothiolan-3-yl)-3-(1,3-thiazol-4-yl)propanoic acid?
2-(1,1-dioxothiolan-3-yl)-3-(1,3-thiazol-4-yl)propanoic acid has a molecular weight of 275.35 g/mol, XLogP of 0.82, 4 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(1,1-dioxothiolan-3-yl)-3-(1,3-thiazol-4-yl)propanoic acid is sourced from PubChem (CID 54982854), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).