C10H13NO4S2 — CID 54982854
2-(1,1-dioxothiolan-3-yl)-3-(1,3-thiazol-4-yl)propanoic acid (PubChem CID 54982854) has the molecular formula C10H13NO4S2 and a molecular weight of 275.35 g/mol. Its IUPAC name is 2-(1,1-dioxothiolan-3-yl)-3-(1,3-thiazol-4-yl)propanoic acid.
| Compound Name | 2-(1,1-dioxothiolan-3-yl)-3-(1,3-thiazol-4-yl)propanoic acid |
|---|---|
| PubChem CID | 54982854 |
| Molecular Formula | C10H13NO4S2 |
| Molecular Weight | 275.35 g/mol |
| Exact Mass | 275.03 |
| IUPAC Name | 2-(1,1-dioxothiolan-3-yl)-3-(1,3-thiazol-4-yl)propanoic acid |
| SMILES | O=C(O)C(Cc1cscn1)C1CCS(=O)(=O)C1 |
| InChI | InChI=1S/C10H13NO4S2/c12-10(13)9(3-8-4-16-6-11-8)7-1-2-17(14,15)5-7/h4,6-7,9H,1-3,5H2,(H,12,13) |
| InChIKey | XMZVWRFLANDEJH-UHFFFAOYSA-N |
| XLogP | 0.82 |
| TPSA | 84.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.35 |
| LogP ≤ 5 | 0.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |