2-(1,1-dioxothiolan-3-yl)propanoic acid

C7H12O4S — CID 57370502

IUPAC2-(1,1-dioxothiolan-3-yl)propanoic acid
SMILESCC(C(=O)O)C1CCS(=O)(=O)C1
InChIInChI=1S/C7H12O4S/c1-5(7(8)9)6-2-3-12(10,11)4-6/h5-6H,2-4H2,1H3,(H,8,9)
InChIKeyUBBSCUBPTFFFEU-UHFFFAOYSA-N
MW192.24 g/mol
LogP0.14
Rot. Bonds2

About 2-(1,1-dioxothiolan-3-yl)propanoic acid

2-(1,1-dioxothiolan-3-yl)propanoic acid (PubChem CID 57370502) has the molecular formula C7H12O4S and a molecular weight of 192.24 g/mol. Its IUPAC name is 2-(1,1-dioxothiolan-3-yl)propanoic acid.

Molecular Properties

Compound Name2-(1,1-dioxothiolan-3-yl)propanoic acid
PubChem CID57370502
Molecular FormulaC7H12O4S
Molecular Weight192.24 g/mol
Exact Mass192.05
IUPAC Name2-(1,1-dioxothiolan-3-yl)propanoic acid
SMILESCC(C(=O)O)C1CCS(=O)(=O)C1
InChIInChI=1S/C7H12O4S/c1-5(7(8)9)6-2-3-12(10,11)4-6/h5-6H,2-4H2,1H3,(H,8,9)
InChIKeyUBBSCUBPTFFFEU-UHFFFAOYSA-N
XLogP0.14
TPSA71.44 Ų
H-Bond Donors1
H-Bond Acceptors3
Rotatable Bonds2
Heavy Atoms12
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500192.24
LogP ≤ 50.14
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 103

Analyze 2-(1,1-dioxothiolan-3-yl)propanoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-(1,1-dioxothiolan-3-yl)propanoic acid?
The IUPAC name of 2-(1,1-dioxothiolan-3-yl)propanoic acid (CID 57370502) is 2-(1,1-dioxothiolan-3-yl)propanoic acid.
What is the SMILES notation for 2-(1,1-dioxothiolan-3-yl)propanoic acid?
The canonical SMILES for 2-(1,1-dioxothiolan-3-yl)propanoic acid is CC(C(=O)O)C1CCS(=O)(=O)C1.
What is the InChIKey of 2-(1,1-dioxothiolan-3-yl)propanoic acid?
The InChIKey is UBBSCUBPTFFFEU-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H12O4S/c1-5(7(8)9)6-2-3-12(10,11)4-6/h5-6H,2-4H2,1H3,(H,8,9).
What are the key properties of 2-(1,1-dioxothiolan-3-yl)propanoic acid?
2-(1,1-dioxothiolan-3-yl)propanoic acid has a molecular weight of 192.24 g/mol, XLogP of 0.14, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(1,1-dioxothiolan-3-yl)propanoic acid is sourced from PubChem (CID 57370502), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).