C7H12O4S — CID 57370502
2-(1,1-dioxothiolan-3-yl)propanoic acid (PubChem CID 57370502) has the molecular formula C7H12O4S and a molecular weight of 192.24 g/mol. Its IUPAC name is 2-(1,1-dioxothiolan-3-yl)propanoic acid.
| Compound Name | 2-(1,1-dioxothiolan-3-yl)propanoic acid |
|---|---|
| PubChem CID | 57370502 |
| Molecular Formula | C7H12O4S |
| Molecular Weight | 192.24 g/mol |
| Exact Mass | 192.05 |
| IUPAC Name | 2-(1,1-dioxothiolan-3-yl)propanoic acid |
| SMILES | CC(C(=O)O)C1CCS(=O)(=O)C1 |
| InChI | InChI=1S/C7H12O4S/c1-5(7(8)9)6-2-3-12(10,11)4-6/h5-6H,2-4H2,1H3,(H,8,9) |
| InChIKey | UBBSCUBPTFFFEU-UHFFFAOYSA-N |
| XLogP | 0.14 |
| TPSA | 71.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 192.24 |
| LogP ≤ 5 | 0.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |