C7H12N2O4S — CID 7073543
2-[(3R)-1,1-dioxothiolan-3-yl]propanediamide (PubChem CID 7073543) has the molecular formula C7H12N2O4S and a molecular weight of 220.25 g/mol. Its IUPAC name is 2-[(3R)-1,1-dioxothiolan-3-yl]propanediamide.
| Compound Name | 2-[(3R)-1,1-dioxothiolan-3-yl]propanediamide |
|---|---|
| PubChem CID | 7073543 |
| Molecular Formula | C7H12N2O4S |
| Molecular Weight | 220.25 g/mol |
| Exact Mass | 220.05 |
| IUPAC Name | 2-[(3R)-1,1-dioxothiolan-3-yl]propanediamide |
| SMILES | NC(=O)C(C(N)=O)[C@H]1CCS(=O)(=O)C1 |
| InChI | InChI=1S/C7H12N2O4S/c8-6(10)5(7(9)11)4-1-2-14(12,13)3-4/h4-5H,1-3H2,(H2,8,10)(H2,9,11)/t4-/m0/s1 |
| InChIKey | CDFRCKQCUOMKER-BYPYZUCNSA-N |
| XLogP | -1.99 |
| TPSA | 120.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.25 |
| LogP ≤ 5 | -1.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|