C8H15NO2S — CID 115336612
1-(1,1-dioxothiolan-3-yl)-2-methylprop-2-en-1-amine (PubChem CID 115336612) has the molecular formula C8H15NO2S and a molecular weight of 189.28 g/mol. Its IUPAC name is 1-(1,1-dioxothiolan-3-yl)-2-methylprop-2-en-1-amine.
| Compound Name | 1-(1,1-dioxothiolan-3-yl)-2-methylprop-2-en-1-amine |
|---|---|
| PubChem CID | 115336612 |
| Molecular Formula | C8H15NO2S |
| Molecular Weight | 189.28 g/mol |
| Exact Mass | 189.08 |
| IUPAC Name | 1-(1,1-dioxothiolan-3-yl)-2-methylprop-2-en-1-amine |
| SMILES | C=C(C)C(N)C1CCS(=O)(=O)C1 |
| InChI | InChI=1S/C8H15NO2S/c1-6(2)8(9)7-3-4-12(10,11)5-7/h7-8H,1,3-5,9H2,2H3 |
| InChIKey | LULJQPZTMLOXQJ-UHFFFAOYSA-N |
| XLogP | 0.32 |
| TPSA | 60.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 189.28 |
| LogP ≤ 5 | 0.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|