C6H10F3NO2S — CID 131521427
1-(1,1-dioxothiolan-3-yl)-2,2,2-trifluoroethanamine (PubChem CID 131521427) has the molecular formula C6H10F3NO2S and a molecular weight of 217.21 g/mol. Its IUPAC name is 1-(1,1-dioxothiolan-3-yl)-2,2,2-trifluoroethanamine.
| Compound Name | 1-(1,1-dioxothiolan-3-yl)-2,2,2-trifluoroethanamine |
|---|---|
| PubChem CID | 131521427 |
| Molecular Formula | C6H10F3NO2S |
| Molecular Weight | 217.21 g/mol |
| Exact Mass | 217.04 |
| IUPAC Name | 1-(1,1-dioxothiolan-3-yl)-2,2,2-trifluoroethanamine |
| SMILES | NC(C1CCS(=O)(=O)C1)C(F)(F)F |
| InChI | InChI=1S/C6H10F3NO2S/c7-6(8,9)5(10)4-1-2-13(11,12)3-4/h4-5H,1-3,10H2 |
| InChIKey | WKPHJOLUTBITEV-UHFFFAOYSA-N |
| XLogP | 0.31 |
| TPSA | 60.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 217.21 |
| LogP ≤ 5 | 0.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |