C9H16F3NO2S — CID 115517578
1-(1,1-dioxothiolan-3-yl)-5,5,5-trifluoropentan-1-amine (PubChem CID 115517578) has the molecular formula C9H16F3NO2S and a molecular weight of 259.29 g/mol. Its IUPAC name is 1-(1,1-dioxothiolan-3-yl)-5,5,5-trifluoropentan-1-amine.
| Compound Name | 1-(1,1-dioxothiolan-3-yl)-5,5,5-trifluoropentan-1-amine |
|---|---|
| PubChem CID | 115517578 |
| Molecular Formula | C9H16F3NO2S |
| Molecular Weight | 259.29 g/mol |
| Exact Mass | 259.09 |
| IUPAC Name | 1-(1,1-dioxothiolan-3-yl)-5,5,5-trifluoropentan-1-amine |
| SMILES | NC(CCCC(F)(F)F)C1CCS(=O)(=O)C1 |
| InChI | InChI=1S/C9H16F3NO2S/c10-9(11,12)4-1-2-8(13)7-3-5-16(14,15)6-7/h7-8H,1-6,13H2 |
| InChIKey | JOKFYIOWUAVOND-UHFFFAOYSA-N |
| XLogP | 1.48 |
| TPSA | 60.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.29 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |