C13H24F3NO2S — CID 105174291
1-(1,1-dioxothiolan-3-yl)-6,6,6-trifluoro-N-propylhexan-2-amine (PubChem CID 105174291) has the molecular formula C13H24F3NO2S and a molecular weight of 315.40 g/mol. Its IUPAC name is 1-(1,1-dioxothiolan-3-yl)-6,6,6-trifluoro-N-propylhexan-2-amine.
| Compound Name | 1-(1,1-dioxothiolan-3-yl)-6,6,6-trifluoro-N-propylhexan-2-amine |
|---|---|
| PubChem CID | 105174291 |
| Molecular Formula | C13H24F3NO2S |
| Molecular Weight | 315.40 g/mol |
| Exact Mass | 315.15 |
| IUPAC Name | 1-(1,1-dioxothiolan-3-yl)-6,6,6-trifluoro-N-propylhexan-2-amine |
| SMILES | CCCNC(CCCC(F)(F)F)CC1CCS(=O)(=O)C1 |
| InChI | InChI=1S/C13H24F3NO2S/c1-2-7-17-12(4-3-6-13(14,15)16)9-11-5-8-20(18,19)10-11/h11-12,17H,2-10H2,1H3 |
| InChIKey | DZOUNIQFKQYWIE-UHFFFAOYSA-N |
| XLogP | 2.91 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.40 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |