C11H23NO2S — CID 105125639
1-(1,1-dioxothiolan-3-yl)-N-methylhexan-2-amine (PubChem CID 105125639) has the molecular formula C11H23NO2S and a molecular weight of 233.38 g/mol. Its IUPAC name is 1-(1,1-dioxothiolan-3-yl)-N-methylhexan-2-amine.
| Compound Name | 1-(1,1-dioxothiolan-3-yl)-N-methylhexan-2-amine |
|---|---|
| PubChem CID | 105125639 |
| Molecular Formula | C11H23NO2S |
| Molecular Weight | 233.38 g/mol |
| Exact Mass | 233.14 |
| IUPAC Name | 1-(1,1-dioxothiolan-3-yl)-N-methylhexan-2-amine |
| SMILES | CCCCC(CC1CCS(=O)(=O)C1)NC |
| InChI | InChI=1S/C11H23NO2S/c1-3-4-5-11(12-2)8-10-6-7-15(13,14)9-10/h10-12H,3-9H2,1-2H3 |
| InChIKey | BOQSHONQQUVHDC-UHFFFAOYSA-N |
| XLogP | 1.59 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.38 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |