C16H33NO2S — CID 61057538
N-[(1,1-dioxothiolan-3-yl)methyl]undecan-6-amine (PubChem CID 61057538) has the molecular formula C16H33NO2S and a molecular weight of 303.51 g/mol. Its IUPAC name is N-[(1,1-dioxothiolan-3-yl)methyl]undecan-6-amine.
| Compound Name | N-[(1,1-dioxothiolan-3-yl)methyl]undecan-6-amine |
|---|---|
| PubChem CID | 61057538 |
| Molecular Formula | C16H33NO2S |
| Molecular Weight | 303.51 g/mol |
| Exact Mass | 303.22 |
| IUPAC Name | N-[(1,1-dioxothiolan-3-yl)methyl]undecan-6-amine |
| SMILES | CCCCCC(CCCCC)NCC1CCS(=O)(=O)C1 |
| InChI | InChI=1S/C16H33NO2S/c1-3-5-7-9-16(10-8-6-4-2)17-13-15-11-12-20(18,19)14-15/h15-17H,3-14H2,1-2H3 |
| InChIKey | XGOLIOXXIXIWFQ-UHFFFAOYSA-N |
| XLogP | 3.54 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.51 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|