C13H27NO2S — CID 54915595
N-[(1,1-dioxothiolan-3-yl)methyl]octan-2-amine (PubChem CID 54915595) has the molecular formula C13H27NO2S and a molecular weight of 261.43 g/mol. Its IUPAC name is N-[(1,1-dioxothiolan-3-yl)methyl]octan-2-amine.
| Compound Name | N-[(1,1-dioxothiolan-3-yl)methyl]octan-2-amine |
|---|---|
| PubChem CID | 54915595 |
| Molecular Formula | C13H27NO2S |
| Molecular Weight | 261.43 g/mol |
| Exact Mass | 261.18 |
| IUPAC Name | N-[(1,1-dioxothiolan-3-yl)methyl]octan-2-amine |
| SMILES | CCCCCCC(C)NCC1CCS(=O)(=O)C1 |
| InChI | InChI=1S/C13H27NO2S/c1-3-4-5-6-7-12(2)14-10-13-8-9-17(15,16)11-13/h12-14H,3-11H2,1-2H3 |
| InChIKey | JEHJUDIPGCTYEY-UHFFFAOYSA-N |
| XLogP | 2.37 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.43 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|