C10H21NO3S — CID 115708252
N-[(1,1-dioxothiolan-3-yl)methyl]-3-methoxybutan-2-amine (PubChem CID 115708252) has the molecular formula C10H21NO3S and a molecular weight of 235.35 g/mol. Its IUPAC name is N-[(1,1-dioxothiolan-3-yl)methyl]-3-methoxybutan-2-amine.
| Compound Name | N-[(1,1-dioxothiolan-3-yl)methyl]-3-methoxybutan-2-amine |
|---|---|
| PubChem CID | 115708252 |
| Molecular Formula | C10H21NO3S |
| Molecular Weight | 235.35 g/mol |
| Exact Mass | 235.12 |
| IUPAC Name | N-[(1,1-dioxothiolan-3-yl)methyl]-3-methoxybutan-2-amine |
| SMILES | COC(C)C(C)NCC1CCS(=O)(=O)C1 |
| InChI | InChI=1S/C10H21NO3S/c1-8(9(2)14-3)11-6-10-4-5-15(12,13)7-10/h8-11H,4-7H2,1-3H3 |
| InChIKey | YDAXRCAVCIGPNM-UHFFFAOYSA-N |
| XLogP | 0.43 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.35 |
| LogP ≤ 5 | 0.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |