C13H26N2O3S — CID 54914910
2-[(1,1-dioxothiolan-3-yl)methylamino]-N-pentan-2-ylpropanamide (PubChem CID 54914910) has the molecular formula C13H26N2O3S and a molecular weight of 290.43 g/mol. Its IUPAC name is 2-[(1,1-dioxothiolan-3-yl)methylamino]-N-pentan-2-ylpropanamide.
| Compound Name | 2-[(1,1-dioxothiolan-3-yl)methylamino]-N-pentan-2-ylpropanamide |
|---|---|
| PubChem CID | 54914910 |
| Molecular Formula | C13H26N2O3S |
| Molecular Weight | 290.43 g/mol |
| Exact Mass | 290.17 |
| IUPAC Name | 2-[(1,1-dioxothiolan-3-yl)methylamino]-N-pentan-2-ylpropanamide |
| SMILES | CCCC(C)NC(=O)C(C)NCC1CCS(=O)(=O)C1 |
| InChI | InChI=1S/C13H26N2O3S/c1-4-5-10(2)15-13(16)11(3)14-8-12-6-7-19(17,18)9-12/h10-12,14H,4-9H2,1-3H3,(H,15,16) |
| InChIKey | SXOUBONGWOTOFS-UHFFFAOYSA-N |
| XLogP | 0.70 |
| TPSA | 75.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.43 |
| LogP ≤ 5 | 0.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |