C13H21NO2S2 — CID 105147931
1-(1,1-dioxothiolan-3-yl)-N-methyl-4-thiophen-3-ylbutan-2-amine (PubChem CID 105147931) has the molecular formula C13H21NO2S2 and a molecular weight of 287.45 g/mol. Its IUPAC name is 1-(1,1-dioxothiolan-3-yl)-N-methyl-4-thiophen-3-ylbutan-2-amine.
| Compound Name | 1-(1,1-dioxothiolan-3-yl)-N-methyl-4-thiophen-3-ylbutan-2-amine |
|---|---|
| PubChem CID | 105147931 |
| Molecular Formula | C13H21NO2S2 |
| Molecular Weight | 287.45 g/mol |
| Exact Mass | 287.10 |
| IUPAC Name | 1-(1,1-dioxothiolan-3-yl)-N-methyl-4-thiophen-3-ylbutan-2-amine |
| SMILES | CNC(CCc1ccsc1)CC1CCS(=O)(=O)C1 |
| InChI | InChI=1S/C13H21NO2S2/c1-14-13(3-2-11-4-6-17-9-11)8-12-5-7-18(15,16)10-12/h4,6,9,12-14H,2-3,5,7-8,10H2,1H3 |
| InChIKey | WOLJUVLBNYNFFD-UHFFFAOYSA-N |
| XLogP | 2.09 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.45 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |