C12H25NO2S — CID 107893846
1-(1,1-dioxothiolan-3-yl)-N,3-dimethylhexan-2-amine (PubChem CID 107893846) has the molecular formula C12H25NO2S and a molecular weight of 247.40 g/mol. Its IUPAC name is 1-(1,1-dioxothiolan-3-yl)-N,3-dimethylhexan-2-amine.
| Compound Name | 1-(1,1-dioxothiolan-3-yl)-N,3-dimethylhexan-2-amine |
|---|---|
| PubChem CID | 107893846 |
| Molecular Formula | C12H25NO2S |
| Molecular Weight | 247.40 g/mol |
| Exact Mass | 247.16 |
| IUPAC Name | 1-(1,1-dioxothiolan-3-yl)-N,3-dimethylhexan-2-amine |
| SMILES | CCCC(C)C(CC1CCS(=O)(=O)C1)NC |
| InChI | InChI=1S/C12H25NO2S/c1-4-5-10(2)12(13-3)8-11-6-7-16(14,15)9-11/h10-13H,4-9H2,1-3H3 |
| InChIKey | YCORGWKFLGVGJW-UHFFFAOYSA-N |
| XLogP | 1.84 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.40 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |