C8H14O4S — CID 84779133
3-(1,1-dioxothiolan-3-yl)-2-methylpropanoic acid (PubChem CID 84779133) has the molecular formula C8H14O4S and a molecular weight of 206.26 g/mol. Its IUPAC name is 3-(1,1-dioxothiolan-3-yl)-2-methylpropanoic acid.
| Compound Name | 3-(1,1-dioxothiolan-3-yl)-2-methylpropanoic acid |
|---|---|
| PubChem CID | 84779133 |
| Molecular Formula | C8H14O4S |
| Molecular Weight | 206.26 g/mol |
| Exact Mass | 206.06 |
| IUPAC Name | 3-(1,1-dioxothiolan-3-yl)-2-methylpropanoic acid |
| SMILES | CC(CC1CCS(=O)(=O)C1)C(=O)O |
| InChI | InChI=1S/C8H14O4S/c1-6(8(9)10)4-7-2-3-13(11,12)5-7/h6-7H,2-5H2,1H3,(H,9,10) |
| InChIKey | WHYGBJMESADTPC-UHFFFAOYSA-N |
| XLogP | 0.53 |
| TPSA | 71.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 206.26 |
| LogP ≤ 5 | 0.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |