C12H23NO2S — CID 105163585
1-(1,1-dioxothiolan-3-yl)-3-methyl-N-propylbut-3-en-2-amine (PubChem CID 105163585) has the molecular formula C12H23NO2S and a molecular weight of 245.39 g/mol. Its IUPAC name is 1-(1,1-dioxothiolan-3-yl)-3-methyl-N-propylbut-3-en-2-amine.
| Compound Name | 1-(1,1-dioxothiolan-3-yl)-3-methyl-N-propylbut-3-en-2-amine |
|---|---|
| PubChem CID | 105163585 |
| Molecular Formula | C12H23NO2S |
| Molecular Weight | 245.39 g/mol |
| Exact Mass | 245.14 |
| IUPAC Name | 1-(1,1-dioxothiolan-3-yl)-3-methyl-N-propylbut-3-en-2-amine |
| SMILES | C=C(C)C(CC1CCS(=O)(=O)C1)NCCC |
| InChI | InChI=1S/C12H23NO2S/c1-4-6-13-12(10(2)3)8-11-5-7-16(14,15)9-11/h11-13H,2,4-9H2,1,3H3 |
| InChIKey | QMVFEIFKVOSXBV-UHFFFAOYSA-N |
| XLogP | 1.76 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.39 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|