C11H20N2O6S — CID 7047075
2-[(3S)-1,1-dioxothiolan-3-yl]-N,N'-bis(2-hydroxyethyl)propanediamide (PubChem CID 7047075) has the molecular formula C11H20N2O6S and a molecular weight of 308.36 g/mol. Its IUPAC name is 2-[(3S)-1,1-dioxothiolan-3-yl]-N,N'-bis(2-hydroxyethyl)propanediamide.
| Compound Name | 2-[(3S)-1,1-dioxothiolan-3-yl]-N,N'-bis(2-hydroxyethyl)propanediamide |
|---|---|
| PubChem CID | 7047075 |
| Molecular Formula | C11H20N2O6S |
| Molecular Weight | 308.36 g/mol |
| Exact Mass | 308.10 |
| IUPAC Name | 2-[(3S)-1,1-dioxothiolan-3-yl]-N,N'-bis(2-hydroxyethyl)propanediamide |
| SMILES | O=C(NCCO)C(C(=O)NCCO)[C@@H]1CCS(=O)(=O)C1 |
| InChI | InChI=1S/C11H20N2O6S/c14-4-2-12-10(16)9(11(17)13-3-5-15)8-1-6-20(18,19)7-8/h8-9,14-15H,1-7H2,(H,12,16)(H,13,17)/t8-/m1/s1 |
| InChIKey | JBPRPMMLWZVNGV-MRVPVSSYSA-N |
| XLogP | -2.75 |
| TPSA | 132.80 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.36 |
| LogP ≤ 5 | -2.75 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|