C9H18N2O4S — CID 117235123
1-[(1,1-dioxothian-3-yl)methyl]-3-(2-hydroxyethyl)urea (PubChem CID 117235123) has the molecular formula C9H18N2O4S and a molecular weight of 250.32 g/mol. Its IUPAC name is 1-[(1,1-dioxothian-3-yl)methyl]-3-(2-hydroxyethyl)urea.
| Compound Name | 1-[(1,1-dioxothian-3-yl)methyl]-3-(2-hydroxyethyl)urea |
|---|---|
| PubChem CID | 117235123 |
| Molecular Formula | C9H18N2O4S |
| Molecular Weight | 250.32 g/mol |
| Exact Mass | 250.10 |
| IUPAC Name | 1-[(1,1-dioxothian-3-yl)methyl]-3-(2-hydroxyethyl)urea |
| SMILES | O=C(NCCO)NCC1CCCS(=O)(=O)C1 |
| InChI | InChI=1S/C9H18N2O4S/c12-4-3-10-9(13)11-6-8-2-1-5-16(14,15)7-8/h8,12H,1-7H2,(H2,10,11,13) |
| InChIKey | IIYZAZLTSOYQTF-UHFFFAOYSA-N |
| XLogP | -0.90 |
| TPSA | 95.50 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.32 |
| LogP ≤ 5 | -0.90 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |