C13H25N3O4S — CID 102566565
N-[6-[(1,1-dioxothiolan-3-yl)methylcarbamoylamino]hexyl]formamide (PubChem CID 102566565) has the molecular formula C13H25N3O4S and a molecular weight of 319.43 g/mol. Its IUPAC name is N-[6-[(1,1-dioxothiolan-3-yl)methylcarbamoylamino]hexyl]formamide.
| Compound Name | N-[6-[(1,1-dioxothiolan-3-yl)methylcarbamoylamino]hexyl]formamide |
|---|---|
| PubChem CID | 102566565 |
| Molecular Formula | C13H25N3O4S |
| Molecular Weight | 319.43 g/mol |
| Exact Mass | 319.16 |
| IUPAC Name | N-[6-[(1,1-dioxothiolan-3-yl)methylcarbamoylamino]hexyl]formamide |
| SMILES | O=CNCCCCCCNC(=O)NCC1CCS(=O)(=O)C1 |
| InChI | InChI=1S/C13H25N3O4S/c17-11-14-6-3-1-2-4-7-15-13(18)16-9-12-5-8-21(19,20)10-12/h11-12H,1-10H2,(H,14,17)(H2,15,16,18) |
| InChIKey | LJLOCVWNJAGTOZ-UHFFFAOYSA-N |
| XLogP | 0.03 |
| TPSA | 104.37 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.43 |
| LogP ≤ 5 | 0.03 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|