C10H21N3O3S — CID 117234704
1-(3-aminopropyl)-3-[(1,1-dioxothian-4-yl)methyl]urea (PubChem CID 117234704) has the molecular formula C10H21N3O3S and a molecular weight of 263.36 g/mol. Its IUPAC name is 1-(3-aminopropyl)-3-[(1,1-dioxothian-4-yl)methyl]urea.
| Compound Name | 1-(3-aminopropyl)-3-[(1,1-dioxothian-4-yl)methyl]urea |
|---|---|
| PubChem CID | 117234704 |
| Molecular Formula | C10H21N3O3S |
| Molecular Weight | 263.36 g/mol |
| Exact Mass | 263.13 |
| IUPAC Name | 1-(3-aminopropyl)-3-[(1,1-dioxothian-4-yl)methyl]urea |
| SMILES | NCCCNC(=O)NCC1CCS(=O)(=O)CC1 |
| InChI | InChI=1S/C10H21N3O3S/c11-4-1-5-12-10(14)13-8-9-2-6-17(15,16)7-3-9/h9H,1-8,11H2,(H2,12,13,14) |
| InChIKey | VFMVZSMKQVVBNS-UHFFFAOYSA-N |
| XLogP | -0.54 |
| TPSA | 101.29 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.36 |
| LogP ≤ 5 | -0.54 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|