C9H19N3O3S — CID 117234622
1-(3-aminopropyl)-3-[(1,1-dioxothiolan-3-yl)methyl]urea (PubChem CID 117234622) has the molecular formula C9H19N3O3S and a molecular weight of 249.34 g/mol. Its IUPAC name is 1-(3-aminopropyl)-3-[(1,1-dioxothiolan-3-yl)methyl]urea.
| Compound Name | 1-(3-aminopropyl)-3-[(1,1-dioxothiolan-3-yl)methyl]urea |
|---|---|
| PubChem CID | 117234622 |
| Molecular Formula | C9H19N3O3S |
| Molecular Weight | 249.34 g/mol |
| Exact Mass | 249.11 |
| IUPAC Name | 1-(3-aminopropyl)-3-[(1,1-dioxothiolan-3-yl)methyl]urea |
| SMILES | NCCCNC(=O)NCC1CCS(=O)(=O)C1 |
| InChI | InChI=1S/C9H19N3O3S/c10-3-1-4-11-9(13)12-6-8-2-5-16(14,15)7-8/h8H,1-7,10H2,(H2,11,12,13) |
| InChIKey | IMIYYRBLNLXELU-UHFFFAOYSA-N |
| XLogP | -0.93 |
| TPSA | 101.29 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.34 |
| LogP ≤ 5 | -0.93 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|