C18H32N2O8S2 — CID 43828162
6-[(1,1-dioxothiolan-3-yl)methylcarbamoyloxy]hexyl N-[(1,1-dioxothiolan-3-yl)methyl]carbamate (PubChem CID 43828162) has the molecular formula C18H32N2O8S2 and a molecular weight of 468.59 g/mol. Its IUPAC name is 6-[(1,1-dioxothiolan-3-yl)methylcarbamoyloxy]hexyl N-[(1,1-dioxothiolan-3-yl)methyl]carbamate.
| Compound Name | 6-[(1,1-dioxothiolan-3-yl)methylcarbamoyloxy]hexyl N-[(1,1-dioxothiolan-3-yl)methyl]carbamate |
|---|---|
| PubChem CID | 43828162 |
| Molecular Formula | C18H32N2O8S2 |
| Molecular Weight | 468.59 g/mol |
| Exact Mass | 468.16 |
| IUPAC Name | 6-[(1,1-dioxothiolan-3-yl)methylcarbamoyloxy]hexyl N-[(1,1-dioxothiolan-3-yl)methyl]carbamate |
| SMILES | O=C(NCC1CCS(=O)(=O)C1)OCCCCCCOC(=O)NCC1CCS(=O)(=O)C1 |
| InChI | InChI=1S/C18H32N2O8S2/c21-17(19-11-15-5-9-29(23,24)13-15)27-7-3-1-2-4-8-28-18(22)20-12-16-6-10-30(25,26)14-16/h15-16H,1-14H2,(H,19,21)(H,20,22) |
| InChIKey | AUNXJWSAXOMKDV-UHFFFAOYSA-N |
| XLogP | 0.87 |
| TPSA | 144.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.59 |
| LogP ≤ 5 | 0.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|