C8H15NO4S — CID 3091624
ethyl N-[(1,1-dioxothiolan-3-yl)methyl]carbamate (PubChem CID 3091624) has the molecular formula C8H15NO4S and a molecular weight of 221.28 g/mol. Its IUPAC name is ethyl N-[(1,1-dioxothiolan-3-yl)methyl]carbamate.
| Compound Name | ethyl N-[(1,1-dioxothiolan-3-yl)methyl]carbamate |
|---|---|
| PubChem CID | 3091624 |
| Molecular Formula | C8H15NO4S |
| Molecular Weight | 221.28 g/mol |
| Exact Mass | 221.07 |
| IUPAC Name | ethyl N-[(1,1-dioxothiolan-3-yl)methyl]carbamate |
| SMILES | CCOC(=O)NCC1CCS(=O)(=O)C1 |
| InChI | InChI=1S/C8H15NO4S/c1-2-13-8(10)9-5-7-3-4-14(11,12)6-7/h7H,2-6H2,1H3,(H,9,10) |
| InChIKey | LZXGUEUTYRFZOS-UHFFFAOYSA-N |
| XLogP | 0.17 |
| TPSA | 72.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 221.28 |
| LogP ≤ 5 | 0.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |