C11H18N2O4S — CID 43827573
[(E)-1-cyclopropylethylideneamino] N-[(1,1-dioxothiolan-3-yl)methyl]carbamate (PubChem CID 43827573) has the molecular formula C11H18N2O4S and a molecular weight of 274.34 g/mol. Its IUPAC name is [(E)-1-cyclopropylethylideneamino] N-[(1,1-dioxothiolan-3-yl)methyl]carbamate.
| Compound Name | [(E)-1-cyclopropylethylideneamino] N-[(1,1-dioxothiolan-3-yl)methyl]carbamate |
|---|---|
| PubChem CID | 43827573 |
| Molecular Formula | C11H18N2O4S |
| Molecular Weight | 274.34 g/mol |
| Exact Mass | 274.10 |
| IUPAC Name | [(E)-1-cyclopropylethylideneamino] N-[(1,1-dioxothiolan-3-yl)methyl]carbamate |
| SMILES | C/C(=N\OC(=O)NCC1CCS(=O)(=O)C1)C1CC1 |
| InChI | InChI=1S/C11H18N2O4S/c1-8(10-2-3-10)13-17-11(14)12-6-9-4-5-18(15,16)7-9/h9-10H,2-7H2,1H3,(H,12,14)/b13-8+ |
| InChIKey | IJRLGGOQIZGLBA-MDWZMJQESA-N |
| XLogP | 0.93 |
| TPSA | 84.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.34 |
| LogP ≤ 5 | 0.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|