C10H17NO5S — CID 82821582
3-[(1,1-dioxothiolan-3-yl)methylamino]-2,2-dimethyl-3-oxopropanoic acid (PubChem CID 82821582) has the molecular formula C10H17NO5S and a molecular weight of 263.31 g/mol. Its IUPAC name is 3-[(1,1-dioxothiolan-3-yl)methylamino]-2,2-dimethyl-3-oxopropanoic acid.
| Compound Name | 3-[(1,1-dioxothiolan-3-yl)methylamino]-2,2-dimethyl-3-oxopropanoic acid |
|---|---|
| PubChem CID | 82821582 |
| Molecular Formula | C10H17NO5S |
| Molecular Weight | 263.31 g/mol |
| Exact Mass | 263.08 |
| IUPAC Name | 3-[(1,1-dioxothiolan-3-yl)methylamino]-2,2-dimethyl-3-oxopropanoic acid |
| SMILES | CC(C)(C(=O)O)C(=O)NCC1CCS(=O)(=O)C1 |
| InChI | InChI=1S/C10H17NO5S/c1-10(2,9(13)14)8(12)11-5-7-3-4-17(15,16)6-7/h7H,3-6H2,1-2H3,(H,11,12)(H,13,14) |
| InChIKey | WJIATNHSOYPCAN-UHFFFAOYSA-N |
| XLogP | -0.35 |
| TPSA | 100.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.31 |
| LogP ≤ 5 | -0.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|