C15H22N2O3S — CID 80554939
2-(4-aminophenyl)-N-[(1,1-dioxothiolan-3-yl)methyl]-2-methylpropanamide (PubChem CID 80554939) has the molecular formula C15H22N2O3S and a molecular weight of 310.42 g/mol. Its IUPAC name is 2-(4-aminophenyl)-N-[(1,1-dioxothiolan-3-yl)methyl]-2-methylpropanamide.
| Compound Name | 2-(4-aminophenyl)-N-[(1,1-dioxothiolan-3-yl)methyl]-2-methylpropanamide |
|---|---|
| PubChem CID | 80554939 |
| Molecular Formula | C15H22N2O3S |
| Molecular Weight | 310.42 g/mol |
| Exact Mass | 310.14 |
| IUPAC Name | 2-(4-aminophenyl)-N-[(1,1-dioxothiolan-3-yl)methyl]-2-methylpropanamide |
| SMILES | CC(C)(C(=O)NCC1CCS(=O)(=O)C1)c1ccc(N)cc1 |
| InChI | InChI=1S/C15H22N2O3S/c1-15(2,12-3-5-13(16)6-4-12)14(18)17-9-11-7-8-21(19,20)10-11/h3-6,11H,7-10,16H2,1-2H3,(H,17,18) |
| InChIKey | OKMYNIRFZPSUOW-UHFFFAOYSA-N |
| XLogP | 1.10 |
| TPSA | 89.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.42 |
| LogP ≤ 5 | 1.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|