C12H20N2O3S — CID 62132151
2-cyano-N-[(1,1-dioxothiolan-3-yl)methyl]-2-ethylbutanamide (PubChem CID 62132151) has the molecular formula C12H20N2O3S and a molecular weight of 272.37 g/mol. Its IUPAC name is 2-cyano-N-[(1,1-dioxothiolan-3-yl)methyl]-2-ethylbutanamide.
| Compound Name | 2-cyano-N-[(1,1-dioxothiolan-3-yl)methyl]-2-ethylbutanamide |
|---|---|
| PubChem CID | 62132151 |
| Molecular Formula | C12H20N2O3S |
| Molecular Weight | 272.37 g/mol |
| Exact Mass | 272.12 |
| IUPAC Name | 2-cyano-N-[(1,1-dioxothiolan-3-yl)methyl]-2-ethylbutanamide |
| SMILES | CCC(C#N)(CC)C(=O)NCC1CCS(=O)(=O)C1 |
| InChI | InChI=1S/C12H20N2O3S/c1-3-12(4-2,9-13)11(15)14-7-10-5-6-18(16,17)8-10/h10H,3-8H2,1-2H3,(H,14,15) |
| InChIKey | KMAMEBBAOYSENJ-UHFFFAOYSA-N |
| XLogP | 0.87 |
| TPSA | 87.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.37 |
| LogP ≤ 5 | 0.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |