C10H19NO4S — CID 79210223
N-[(1,1-dioxothiolan-3-yl)methyl]-5-hydroxypentanamide (PubChem CID 79210223) has the molecular formula C10H19NO4S and a molecular weight of 249.33 g/mol. Its IUPAC name is N-[(1,1-dioxothiolan-3-yl)methyl]-5-hydroxypentanamide.
| Compound Name | N-[(1,1-dioxothiolan-3-yl)methyl]-5-hydroxypentanamide |
|---|---|
| PubChem CID | 79210223 |
| Molecular Formula | C10H19NO4S |
| Molecular Weight | 249.33 g/mol |
| Exact Mass | 249.10 |
| IUPAC Name | N-[(1,1-dioxothiolan-3-yl)methyl]-5-hydroxypentanamide |
| SMILES | O=C(CCCCO)NCC1CCS(=O)(=O)C1 |
| InChI | InChI=1S/C10H19NO4S/c12-5-2-1-3-10(13)11-7-9-4-6-16(14,15)8-9/h9,12H,1-8H2,(H,11,13) |
| InChIKey | LQACSMFCAWNTRZ-UHFFFAOYSA-N |
| XLogP | -0.30 |
| TPSA | 83.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.33 |
| LogP ≤ 5 | -0.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|