C15H20ClNO4S — CID 94345213
4-(2-chlorophenoxy)-N-[[(3S)-1,1-dioxothiolan-3-yl]methyl]butanamide (PubChem CID 94345213) has the molecular formula C15H20ClNO4S and a molecular weight of 345.85 g/mol. Its IUPAC name is 4-(2-chlorophenoxy)-N-[[(3S)-1,1-dioxothiolan-3-yl]methyl]butanamide.
| Compound Name | 4-(2-chlorophenoxy)-N-[[(3S)-1,1-dioxothiolan-3-yl]methyl]butanamide |
|---|---|
| PubChem CID | 94345213 |
| Molecular Formula | C15H20ClNO4S |
| Molecular Weight | 345.85 g/mol |
| Exact Mass | 345.08 |
| IUPAC Name | 4-(2-chlorophenoxy)-N-[[(3S)-1,1-dioxothiolan-3-yl]methyl]butanamide |
| SMILES | O=C(CCCOc1ccccc1Cl)NC[C@@H]1CCS(=O)(=O)C1 |
| InChI | InChI=1S/C15H20ClNO4S/c16-13-4-1-2-5-14(13)21-8-3-6-15(18)17-10-12-7-9-22(19,20)11-12/h1-2,4-5,12H,3,6-11H2,(H,17,18)/t12-/m0/s1 |
| InChIKey | FQBFZLQPIPROFG-LBPRGKRZSA-N |
| XLogP | 2.05 |
| TPSA | 72.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.85 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|